cas: 951127-25-6 — see every product listed under this CAS number, including other names
tert-Butyl ((2R,3S)-2-(2,5-difluorophenyl)-5-oxotetrahydro-2H-pyran-3-yl)carbamate 95% (CAS 951127-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804850-100mg |
| cas | 951127-25-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 782.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A804850 |
Tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate (CAS 951127-25-6) is a chemical compound with the molecular formula C16H19F2NO4 and a molecular weight of 327.32 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate. InChIKey: OTCULXVRRSCLLI-UONOGXRCSA-N.
| Molecular formula | C16H19F2NO4 |
|---|---|
| Molecular weight | 327.32 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate |
| InChIKey | OTCULXVRRSCLLI-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)CO[C@@H]1C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)