CAS 951127-25-6 appears in our catalog under these names: tert-Butyl ((2r,3s)-2-(2,5-difluorophenyl)-5-oxotetrahydro-2h-pyran-3-yl)carbamate, 95%, N-[(2R,3S)-2-(2,5-Difluorophenyl)tetrahydro-5-oxo-2H-pyran-3-yl]carbamic acid 1,1-dimethylethyl ester, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 100g, 100mg, 250mg, 10g.
Tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate (CAS 951127-25-6) is a chemical compound with the molecular formula C16H19F2NO4 and a molecular weight of 327.32 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate. InChIKey: OTCULXVRRSCLLI-UONOGXRCSA-N.
| Molecular formula | C16H19F2NO4 |
|---|---|
| Molecular weight | 327.32 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate |
| InChIKey | OTCULXVRRSCLLI-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)CO[C@@H]1C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)