cas: 1523606-21-4 — see every product listed under this CAS number, including other names
tert-Butyl ((3-methylazetidin-3-yl)methyl)carbamate hydrochloride, 97%, 97% (CAS 1523606-21-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY1D-100mg |
| cas | 1523606-21-4 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1360.40 Pln | |
| Chemat | 10g | 2195.60 Pln | |
| Chemat | 25g | 4706.00 Pln | |
| Chemat | 100g | 12131.60 Pln | |
| Chemat | 500mg | 294.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;hydrochloride (CAS 1523606-21-4) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;hydrochloride. InChIKey: MEKMYVUXVYVJJK-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3-methylazetidin-3-yl)methyl]carbamate;hydrochloride |
| InChIKey | MEKMYVUXVYVJJK-UHFFFAOYSA-N |
| SMILES | CC1(CNC1)CNC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)