Products 2377915-61-0
CAS 2377915-61-0 is the registry number for Trans-1-Boc-3-amino-4-methylpyrrolidine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl (4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride (CAS 2377915-61-0) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: IXBLNFDWECFVSM-JPPWUZRISA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (4S)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | IXBLNFDWECFVSM-JPPWUZRISA-N |
| SMILES | C[C@H]1CN(CC1N)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)