cas: 1628794-75-1 — see every product listed under this CAS number, including other names
tert-Butyl ((3R,4S)-4-aminotetrahydrofuran-3-yl)carbamate 95% (CAS 1628794-75-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A226613-100mg |
| cas | 1628794-75-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 859.88 Pln | |
| Ambeed | 1g | 2033.56 Pln | |
| Ambeed | 5g | 6939.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A226613 |
Tert-butyl N-[(3R,4S)-4-aminooxolan-3-yl]carbamate (CAS 1628794-75-1) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-aminooxolan-3-yl]carbamate. InChIKey: HWYDCYLRWDJCCH-RQJHMYQMSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-aminooxolan-3-yl]carbamate |
| InChIKey | HWYDCYLRWDJCCH-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COC[C@H]1N |
Computed by PubChem (NCBI)