cas: 1188475-96-8 — see every product listed under this CAS number, including other names
tert-Butyl ((4-hydroxycyclohexyl)methyl)carbamate (CAS 1188475-96-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238420-5G |
| cas | 1188475-96-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 4876.43 Pln | |
| Fluorochem | 1g | 1559.89 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-[(4-hydroxycyclohexyl)methyl]carbamate (CAS 1188475-96-8) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl N-[(4-hydroxycyclohexyl)methyl]carbamate. InChIKey: XWYVCQSOGJIMPK-UHFFFAOYSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl N-[(4-hydroxycyclohexyl)methyl]carbamate |
| InChIKey | XWYVCQSOGJIMPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)O |
Computed by PubChem (NCBI)