cas: 1780934-03-3 — see every product listed under this CAS number, including other names
tert-Butyl ((5-aminopyridin-2-yl)methyl)carbamate 95+% (CAS 1780934-03-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A839196-100mg |
| cas | 1780934-03-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 1154.69 Pln | |
| Ambeed | 1g | 2895.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A839196 |
Tert-butyl N-[(5-amino-2-pyridinyl)methyl]carbamate (CAS 1780934-03-3) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[(5-amino-2-pyridinyl)methyl]carbamate. InChIKey: SXOULXWJHXPVAX-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[(5-amino-2-pyridinyl)methyl]carbamate |
| InChIKey | SXOULXWJHXPVAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC=C(C=C1)N |
Computed by PubChem (NCBI)