cas: 247068-82-2 — see every product listed under this CAS number, including other names
tert-Butyl ((S)-4-methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)carbamate, 95% (CAS 247068-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F497427-100MG |
| cas | 247068-82-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 253.05 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 997.58 Pln | |
| Fluorochem | 10g | 1934.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]carbamate (CAS 247068-82-2) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: tert-butyl N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]carbamate. InChIKey: DDMPMIMTLBGEHT-IINYFYTJSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]carbamate |
| InChIKey | DDMPMIMTLBGEHT-IINYFYTJSA-N |
| SMILES | CC(C)C[C@@H](C(=O)[C@]1(CO1)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)