cas: 166168-16-7 — see every product listed under this CAS number, including other names
tert-Butyl ((trans-4-(aminomethyl)cyclohexyl)methyl)carbamate 98% (CAS 166168-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A838743-250mg |
| cas | 166168-16-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Ambeed | 5g | 2395.12 Pln | |
| Ambeed | 10g | 4147.31 Pln | |
| Ambeed | 25g | 8219.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A838743 |
Tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate (CAS 166168-16-7) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate. InChIKey: NYXOBVVHJZENCO-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate |
| InChIKey | NYXOBVVHJZENCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)CN |
Computed by PubChem (NCBI)