cas: 219862-14-3 — see every product listed under this CAS number, including other names
tert-Butyl (1,2,3,4-tetrahydroquinolin-3-yl)carbamate 97% (CAS 219862-14-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184552-100mg |
| cas | 219862-14-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1844.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184552 |
Tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate (CAS 219862-14-3) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate. InChIKey: GAURNOYXRZQBNV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | tert-butyl N-(1,2,3,4-tetrahydroquinolin-3-yl)carbamate |
| InChIKey | GAURNOYXRZQBNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC2=CC=CC=C2NC1 |
Computed by PubChem (NCBI)