cas: 850568-79-5 — see every product listed under this CAS number, including other names
tert-Butyl (1-hydroxy-1,3-dihydrobenzo[c][1,2]oxaborol-6-yl)carbamate 98% (CAS 850568-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535761-100mg |
| cas | 850568-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 965.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A535761 |
Tert-butyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate (CAS 850568-79-5) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: tert-butyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate. InChIKey: PHTYIDJNPFQYPQ-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | tert-butyl N-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)carbamate |
| InChIKey | PHTYIDJNPFQYPQ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)