CAS 1315340-58-9 is the registry number for 5-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylic acid (CAS 1315340-58-9) is a chemical compound with the molecular formula C12H16BNO4 and a molecular weight of 249.07 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylic acid. InChIKey: ZKLNHTITLZJRAK-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4 |
|---|---|
| Molecular weight | 249.07 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylic acid |
| InChIKey | ZKLNHTITLZJRAK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)