cas: 194222-05-4 — see every product listed under this CAS number, including other names
tert-Butyl (1R,3s,5S)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate, 97% (CAS 194222-05-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334369-250MG |
| cas | 194222-05-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 96.86 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1294.35 Pln | |
| Fluorochem | 25g | 2700.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 194222-05-4) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: SEGZJJSZYOEABC-ULKQDVFKSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (1S,5R)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | SEGZJJSZYOEABC-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)O |
Computed by PubChem (NCBI)