cas: 402958-62-7 — see every product listed under this CAS number, including other names
tert-Butyl (2,5-dioxopyrrolidin-1-yl) adipate 95% (CAS 402958-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A737035-100mg |
| cas | 402958-62-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2167.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A737035 |
1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate (CAS 402958-62-7) is a chemical compound with the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. IUPAC name: 1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate. InChIKey: XMOQYFHEYDMGSR-UHFFFAOYSA-N.
| Molecular formula | C14H21NO6 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate |
| InChIKey | XMOQYFHEYDMGSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)