CAS 402958-62-7 appears in our catalog under these names: tert-Butyl (2,5-dioxopyrrolidin-1-yl) adipate, 95%, tert–Butyl (2,5–dioxopyrrolidin–1–yl) adipate, Hexanedioic acid tert-butyl ester 2,5-dioxopyrrolidin-1-yl ester, 95%, 95%, 6-(tert-Butoxy)-6-oxohexanoic NHS ester. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 250 mg, 25 mg, 50 mg, 1 g.
1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate (CAS 402958-62-7) is a chemical compound with the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. IUPAC name: 1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate. InChIKey: XMOQYFHEYDMGSR-UHFFFAOYSA-N.
| Molecular formula | C14H21NO6 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-(2,5-dioxopyrrolidin-1-yl) hexanedioate |
| InChIKey | XMOQYFHEYDMGSR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)