cas: 1117693-61-4 — see every product listed under this CAS number, including other names
tert-Butyl (2-amino-3-methylbutyl)carbamate, 97% (CAS 1117693-61-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F762381-250MG |
| cas | 1117693-61-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1539.06 Pln | |
| Fluorochem | 500mg | 2424.16 Pln | |
| Fluorochem | 1g | 3600.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-amino-3-methylbutyl)carbamate (CAS 1117693-61-4) is a chemical compound with the molecular formula C10H22N2O2 and a molecular weight of 202.29 g/mol. IUPAC name: tert-butyl N-(2-amino-3-methylbutyl)carbamate. InChIKey: YWAMFTBALAAREO-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O2 |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | tert-butyl N-(2-amino-3-methylbutyl)carbamate |
| InChIKey | YWAMFTBALAAREO-UHFFFAOYSA-N |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)