cas: 152193-00-5 — see every product listed under this CAS number, including other names
tert-Butyl (2-aminoethyl)(benzyl)carbamate, 95%, 95% (CAS 152193-00-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149A8-1g |
| cas | 152193-00-5 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1970.00 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1024.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-aminoethyl)-N-benzylcarbamate (CAS 152193-00-5) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: tert-butyl N-(2-aminoethyl)-N-benzylcarbamate. InChIKey: NFGJZHRLYRSRPU-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | tert-butyl N-(2-aminoethyl)-N-benzylcarbamate |
| InChIKey | NFGJZHRLYRSRPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCN)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)