cas: 86499-69-6 — see every product listed under this CAS number, including other names
tert-Butyl (2-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepin-3-yl)carbamate, 97%, 97% (CAS 86499-69-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115VAT-100mg |
| cas | 86499-69-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 410.00 Pln | |
| Chemat | 1g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamate (CAS 86499-69-6) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: tert-butyl N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamate. InChIKey: KMQMLZIXVMSMOI-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | tert-butyl N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl)carbamate |
| InChIKey | KMQMLZIXVMSMOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2=CC=CC=C2NC1=O |
Computed by PubChem (NCBI)