cas: 2306249-72-7 — see every product listed under this CAS number, including other names
tert-Butyl (2R,5S)-5-amino-2-methylpiperidine-1-carboxylate, 95% (CAS 2306249-72-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1376854-250mg |
| cas | 2306249-72-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1699.81 Pln | |
| Ambeed | 1g | 4141.75 Pln | |
| BLDpharm | 50mg | 658.68 Pln | |
| BLDpharm | 100mg | 947.47 Pln | |
| BLDpharm | 250mg | 1824.94 Pln | |
| BLDpharm | 1g | 4457.34 Pln | |
| Fluorochem | 100mg | 1497.41 Pln | |
| Fluorochem | 250mg | 2892.75 Pln | |
| Fluorochem | 1g | 7333.89 Pln | |
| Fluorochem | 500mg | 5017.00 Pln | |
| Fluorochem | 5g | 21834.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (2R,5S)-5-amino-2-methylpiperidine-1-carboxylate (CAS 2306249-72-7) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2R,5S)-5-amino-2-methylpiperidine-1-carboxylate. InChIKey: ZKBBQGSSDAJNKG-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2R,5S)-5-amino-2-methylpiperidine-1-carboxylate |
| InChIKey | ZKBBQGSSDAJNKG-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)