cas: 1932542-32-9 — see every product listed under this CAS number, including other names
tert-Butyl (2S,4R)-4-amino-2-methylpiperidine-1-carboxylate 97% (CAS 1932542-32-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A711518-25mg |
| cas | 1932542-32-9 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 592.88 Pln | |
| Ambeed | 50mg | 954.44 Pln | |
| Ambeed | 100mg | 1571.88 Pln | |
| Ambeed | 250mg | 1877.81 Pln | |
| Ambeed | 1g | 3691.19 Pln | |
| Ambeed | 5g | 10928.00 Pln | |
| Ambeed | 10g | 18170.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A711518 |
Tert-butyl (2S,4R)-4-amino-2-methylpiperidine-1-carboxylate (CAS 1932542-32-9) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2S,4R)-4-amino-2-methylpiperidine-1-carboxylate. InChIKey: OGIPSHDJYIEDKG-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2S,4R)-4-amino-2-methylpiperidine-1-carboxylate |
| InChIKey | OGIPSHDJYIEDKG-DTWKUNHWSA-N |
| SMILES | C[C@H]1C[C@@H](CCN1C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)