cas: 1609123-53-6 — see every product listed under this CAS number, including other names
tert-Butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate 97% (CAS 1609123-53-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A979774-10g |
| cas | 1609123-53-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1950.12 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1243.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A979774 |
Tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate (CAS 1609123-53-6) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate. InChIKey: UNVNZVOSYRUJTH-YUMQZZPRSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | tert-butyl (2S,4S)-2-cyano-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | UNVNZVOSYRUJTH-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C#N)O |
Computed by PubChem (NCBI)