cas: 1208170-37-9 — see every product listed under this CAS number, including other names
tert-Butyl (3-(3-aminophenyl)propyl)carbamate (CAS 1208170-37-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F762453-250MG |
| cas | 1208170-37-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1070.47 Pln | |
| Fluorochem | 1g | 2726.14 Pln | |
| Fluorochem | 5g | 6797.62 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-[3-(3-aminophenyl)propyl]carbamate (CAS 1208170-37-9) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: tert-butyl N-[3-(3-aminophenyl)propyl]carbamate. InChIKey: HMQFNKDFTUKLPA-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | tert-butyl N-[3-(3-aminophenyl)propyl]carbamate |
| InChIKey | HMQFNKDFTUKLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC1=CC(=CC=C1)N |
Computed by PubChem (NCBI)