cas: 1175298-09-5 — see every product listed under this CAS number, including other names
tert-Butyl (3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl)carbamate 95% (CAS 1175298-09-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117005-10g |
| cas | 1175298-09-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 7885.31 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1126.88 Pln | |
| Ambeed | 5g | 4508.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117005 |
Tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate (CAS 1175298-09-5) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate. InChIKey: MFPBSOYHSNYOKC-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate |
| InChIKey | MFPBSOYHSNYOKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCC(C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)