cas: 1175298-09-5 — see every product listed under this CAS number, including other names
tert-Butyl (3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl)carbamate, 95%, 95% (CAS 1175298-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50mg, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11051N-100mg |
| cas | 1175298-09-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln | |
| Chemat | 50mg | 170.00 Pln | |
| Chemat | 25g | 6952.40 Pln | |
| Chemat | 50g | 8915.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate (CAS 1175298-09-5) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate. InChIKey: MFPBSOYHSNYOKC-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-3-en-1-yl]carbamate |
| InChIKey | MFPBSOYHSNYOKC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCC(C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)