cas: 361548-95-0 — see every product listed under this CAS number, including other names
tert-Butyl (3-amino-4-fluorophenyl)carbamate 98% (CAS 361548-95-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A328301-1g |
| cas | 361548-95-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 314.75 Pln | |
| Ambeed | 25g | 1293.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A328301 |
Tert-butyl N-(3-amino-4-fluorophenyl)carbamate (CAS 361548-95-0) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(3-amino-4-fluorophenyl)carbamate. InChIKey: VWFNJRUKTFGZJN-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(3-amino-4-fluorophenyl)carbamate |
| InChIKey | VWFNJRUKTFGZJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)