CAS 579474-47-8 appears in our catalog under these names: (2-Amino-4-fluoro-phenyl)-carbamic acid tert-butyl ester, 95%, N1–(tert–Butoxycarbonyl)–4–fluoro–1,2–phenylenediamine, N1-(tert-Butoxycarbonyl)-4-fluoro-1,2-phenylenediamine, >98.0%(T), tert-Butyl 2-amino-4-fluorophenylcarbamate 98%, tert-Butyl 2-amino-4-fluorophenylcarbamate, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg, 100mg, 10g.
Tert-butyl N-(2-amino-4-fluorophenyl)carbamate (CAS 579474-47-8) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(2-amino-4-fluorophenyl)carbamate. InChIKey: IBKSOWUYKOORFF-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(2-amino-4-fluorophenyl)carbamate |
| InChIKey | IBKSOWUYKOORFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)F)N |
Computed by PubChem (NCBI)