cas: 347186-01-0 — see every product listed under this CAS number, including other names
tert-Butyl (3-aminocyclohexyl)carbamate, 95%, 95% (CAS 347186-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140SV-100mg |
| cas | 347186-01-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1211.60 Pln | |
| Chemat | 25g | 4538.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3-aminocyclohexyl)carbamate (CAS 347186-01-0) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-(3-aminocyclohexyl)carbamate. InChIKey: OBSACSBMTRJNPH-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-(3-aminocyclohexyl)carbamate |
| InChIKey | OBSACSBMTRJNPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(C1)N |
Computed by PubChem (NCBI)