cas: 429673-83-6 — see every product listed under this CAS number, including other names
tert-Butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate, 97% (CAS 429673-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602455-100MG |
| cas | 429673-83-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 500mg | 1174.60 Pln | |
| Fluorochem | 1g | 1434.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate (CAS 429673-83-6) is a chemical compound with the molecular formula C16H24N2O3 and a molecular weight of 292.37 g/mol. IUPAC name: tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate. InChIKey: GVYATPKTSSTHKN-ZIAGYGMSSA-N.
| Molecular formula | C16H24N2O3 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-(benzylamino)-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | GVYATPKTSSTHKN-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)