cas: 1821799-48-7 — see every product listed under this CAS number, including other names
tert-Butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate 97% (CAS 1821799-48-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A711227-100mg |
| cas | 1821799-48-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1171.38 Pln | |
| Ambeed | 1g | 2267.19 Pln | |
| Ambeed | 5g | 9186.94 Pln | |
| Ambeed | 10g | 14660.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A711227 |
Tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 1821799-48-7) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: KREUZCYJWPQPJX-JGVFFNPUSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | KREUZCYJWPQPJX-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)