cas: 1630906-54-5 — see every product listed under this CAS number, including other names
tert-Butyl (4-aminobicyclo[2.2.2]octan-1-yl)carbamate, 97.0% (CAS 1630906-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 500 mg, 100 mg, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-22289-1 g |
| cas | 1630906-54-5 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 3143.24 Pln | |
| MedChemExpress | 500 mg | 1894.01 Pln | |
| MedChemExpress | 100 mg | 719.08 Pln | |
| MedChemExpress | 5 g | 10267.14 Pln | |
| MedChemExpress | 250 mg | 1150.97 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate (CAS 1630906-54-5) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate. InChIKey: GRVKFPSOHUZDAY-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate |
| InChIKey | GRVKFPSOHUZDAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(CC1)(CC2)N |
Computed by PubChem (NCBI)