cas: 1630906-54-5 — see every product listed under this CAS number, including other names
tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate, 95% (CAS 1630906-54-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F512709-100MG |
| cas | 1630906-54-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 971.55 Pln | |
| Fluorochem | 500mg | 1434.93 Pln | |
| Fluorochem | 1g | 2424.16 Pln | |
| Fluorochem | 5g | 7844.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate (CAS 1630906-54-5) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate. InChIKey: GRVKFPSOHUZDAY-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl N-(4-amino-1-bicyclo[2.2.2]octanyl)carbamate |
| InChIKey | GRVKFPSOHUZDAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(CC1)(CC2)N |
Computed by PubChem (NCBI)