cas: 209958-42-9 — see every product listed under this CAS number, including other names
tert-Butyl (4-bromo-2-fluorophenyl)carbamate, 99%, 99% (CAS 209958-42-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114STC-1g |
| cas | 209958-42-9 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 352.40 Pln | |
| Chemat | 25g | 640.40 Pln | |
| Chemat | 100g | 1907.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-bromo-2-fluorophenyl)carbamate (CAS 209958-42-9) is a chemical compound with the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. IUPAC name: tert-butyl N-(4-bromo-2-fluorophenyl)carbamate. InChIKey: DMHILFAMOKMHSO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO2 |
|---|---|
| Molecular weight | 290.13 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2-fluorophenyl)carbamate |
| InChIKey | DMHILFAMOKMHSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)