cas: 60144-53-8 — see every product listed under this CAS number, including other names
tert-Butyl (4-fluorophenyl)carbamate, 98% (CAS 60144-53-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692211-10G |
| cas | 60144-53-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 310.33 Pln | |
| Fluorochem | 100g | 919.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-fluorophenyl)carbamate (CAS 60144-53-8) is a chemical compound with the molecular formula C11H14FNO2 and a molecular weight of 211.23 g/mol. IUPAC name: tert-butyl N-(4-fluorophenyl)carbamate. InChIKey: OJVWNENFSPSLRB-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2 |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | tert-butyl N-(4-fluorophenyl)carbamate |
| InChIKey | OJVWNENFSPSLRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)