cas: 304873-96-9 — see every product listed under this CAS number, including other names
tert-Butyl (5-(bromomethyl)pyridin-2-yl)carbamate 97% (CAS 304873-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A655261-100mg |
| cas | 304873-96-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1377.19 Pln | |
| Ambeed | 5g | 3763.50 Pln | |
| Ambeed | 10g | 6305.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A655261 |
Tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate (CAS 304873-96-9) is a chemical compound with the molecular formula C11H15BrN2O2 and a molecular weight of 287.15 g/mol. IUPAC name: tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate. InChIKey: JKBGHFXEMZZLFY-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O2 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | tert-butyl N-[5-(bromomethyl)-2-pyridinyl]carbamate |
| InChIKey | JKBGHFXEMZZLFY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)CBr |
Computed by PubChem (NCBI)