cas: 1150618-39-5 — see every product listed under this CAS number, including other names
tert-Butyl (6-methylpiperidin-3-yl)carbamate, 97%, 97% (CAS 1150618-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FTZ-100mg |
| cas | 1150618-39-5 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2080.40 Pln | |
| Chemat | 10g | 3146.00 Pln | |
| Chemat | 25g | 5805.20 Pln | |
| Chemat | 500mg | 621.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(6-methylpiperidin-3-yl)carbamate (CAS 1150618-39-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-(6-methylpiperidin-3-yl)carbamate. InChIKey: NNMBHCRWGGSRBE-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-(6-methylpiperidin-3-yl)carbamate |
| InChIKey | NNMBHCRWGGSRBE-UHFFFAOYSA-N |
| SMILES | CC1CCC(CN1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)