cas: 510754-90-2 — see every product listed under this CAS number, including other names
tert-Butyl (9-aminononyl)carbamate, 97%, 97% (CAS 510754-90-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117TZA-50mg |
| cas | 510754-90-2 |
| size | 50mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 189.20 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 2896.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(9-aminononyl)carbamate (CAS 510754-90-2) is a chemical compound with the molecular formula C14H30N2O2 and a molecular weight of 258.40 g/mol. IUPAC name: tert-butyl N-(9-aminononyl)carbamate. InChIKey: GZUNGYDAMPRXSU-UHFFFAOYSA-N.
| Molecular formula | C14H30N2O2 |
|---|---|
| Molecular weight | 258.40 g/mol |
| IUPAC name | tert-butyl N-(9-aminononyl)carbamate |
| InChIKey | GZUNGYDAMPRXSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCCN |
Computed by PubChem (NCBI)