Products 510754-90-2
CAS 510754-90-2 appears in our catalog under these names: 1-Boc-1,9-diaminononane, 97%, tert–Butyl (9–aminononyl)carbamate, tert-Butyl (9-aminononyl)carbamate, tert-Butyl (9-aminononyl)carbamate 97%, tert-Butyl (9-aminononyl)carbamate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 50mg, 2g, 10g, 100mg, 250 mg.
Tert-butyl N-(9-aminononyl)carbamate (CAS 510754-90-2) is a chemical compound with the molecular formula C14H30N2O2 and a molecular weight of 258.40 g/mol. IUPAC name: tert-butyl N-(9-aminononyl)carbamate. InChIKey: GZUNGYDAMPRXSU-UHFFFAOYSA-N.
| Molecular formula | C14H30N2O2 |
|---|---|
| Molecular weight | 258.40 g/mol |
| IUPAC name | tert-butyl N-(9-aminononyl)carbamate |
| InChIKey | GZUNGYDAMPRXSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCCN |
Computed by PubChem (NCBI)