cas: 1033748-33-2 — see every product listed under this CAS number, including other names
tert-Butyl (trans-3-methoxypiperidin-4-yl)carbamate 95% (CAS 1033748-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A594940-100mg |
| cas | 1033748-33-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 960.00 Pln | |
| Ambeed | 250mg | 1494.00 Pln | |
| Ambeed | 1g | 3618.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A594940 |
Tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate (CAS 1033748-33-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate. InChIKey: BSSCFNOPCQQJAZ-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate |
| InChIKey | BSSCFNOPCQQJAZ-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@H]1OC |
Computed by PubChem (NCBI)