cas: 1033748-33-2 — see every product listed under this CAS number, including other names
trans-4-(Boc-amino)-3-methoxypiperidine, 95%, 95% (CAS 1033748-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HA35-100mg |
| cas | 1033748-33-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 789.20 Pln | |
| Chemat | 250mg | 1230.80 Pln | |
| Chemat | 1g | 2982.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate (CAS 1033748-33-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate. InChIKey: BSSCFNOPCQQJAZ-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-3-methoxypiperidin-4-yl]carbamate |
| InChIKey | BSSCFNOPCQQJAZ-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@H]1OC |
Computed by PubChem (NCBI)