cas: 1620483-21-7 — see every product listed under this CAS number, including other names
tert-Butyl 1,2,6-triazaspiro[2.5]oct-1-ene-6-carboxylate, 95%, 95% (CAS 1620483-21-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWPN-1g |
| cas | 1620483-21-7 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1312.40 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 381.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1,2,6-triazaspiro[2.5]oct-1-ene-6-carboxylate (CAS 1620483-21-7) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl 1,2,6-triazaspiro[2.5]oct-1-ene-6-carboxylate. InChIKey: KSWQVISMOCJORL-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl 1,2,6-triazaspiro[2.5]oct-1-ene-6-carboxylate |
| InChIKey | KSWQVISMOCJORL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)N=N2 |
Computed by PubChem (NCBI)