cas: 1272412-72-2 — see every product listed under this CAS number, including other names
tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate 98% (CAS 1272412-72-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A367104-50mg |
| cas | 1272412-72-2 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 481.62 Pln | |
| Ambeed | 100mg | 765.31 Pln | |
| Ambeed | 250mg | 1188.06 Pln | |
| Ambeed | 1g | 2673.25 Pln | |
| Ambeed | 5g | 9198.06 Pln | |
| Ambeed | 10g | 14677.13 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A367104 |
Tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate (CAS 1272412-72-2) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate. InChIKey: WDVOLHDNUMLNAK-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate |
| InChIKey | WDVOLHDNUMLNAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN2 |
Computed by PubChem (NCBI)