cas: 1523618-28-1 — see every product listed under this CAS number, including other names
tert-Butyl 1,6-diazaspiro[3.4]octane-6-carboxylate oxalate(2:1), 97%, 97% (CAS 1523618-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY2H-100mg |
| cas | 1523618-28-1 |
| size | 100mg |
| availability | 2.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 1010.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid (CAS 1523618-28-1) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid. InChIKey: QWDNPUMDBPYQKI-UHFFFAOYSA-N.
| Molecular formula | C24H42N4O8 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | bis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid |
| InChIKey | QWDNPUMDBPYQKI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCN2.CC(C)(C)OC(=O)N1CCC2(C1)CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)