Products 1523618-28-1

CAS 1523618-28-1 appears in our catalog under these names: tert-Butyl 1,6-diazaspiro[3.4]octane-6-carboxylate hemioxalate, 95%, tert-Butyl 1,6-diazaspiro[3.4]octane-6-carboxylate oxalate(2:1) 97%, tert-Butyl 1,6-diazaspiro[3.4]octane-6-carboxylate oxalate(2:1), 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid (CAS 1523618-28-1) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid. InChIKey: QWDNPUMDBPYQKI-UHFFFAOYSA-N.

Identity
Molecular formulaC24H42N4O8
Molecular weight514.6 g/mol
IUPAC namebis(tert-butyl 1,7-diazaspiro[3.4]octane-7-carboxylate);oxalic acid
InChIKeyQWDNPUMDBPYQKI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CCN2.CC(C)(C)OC(=O)N1CCC2(C1)CCN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)