cas: 1251003-21-0 — see every product listed under this CAS number, including other names
tert-Butyl 1,8-dioxa-4,11-diazaspiro[5.6]dodecane-4-carboxylate, 97%, 97% (CAS 1251003-21-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DM18-100mg |
| cas | 1251003-21-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1178.00 Pln | |
| Chemat | 250mg | 1840.40 Pln | |
| Chemat | 500mg | 3026.00 Pln | |
| Chemat | 1g | 4504.40 Pln | |
| Chemat | 5g | 13389.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1,11-dioxa-4,8-diazaspiro[5.6]dodecane-4-carboxylate (CAS 1251003-21-0) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: tert-butyl 1,11-dioxa-4,8-diazaspiro[5.6]dodecane-4-carboxylate. InChIKey: UKHJZGXMSBYRMO-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | tert-butyl 1,11-dioxa-4,8-diazaspiro[5.6]dodecane-4-carboxylate |
| InChIKey | UKHJZGXMSBYRMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2(C1)CNCCOC2 |
Computed by PubChem (NCBI)