cas: 581065-94-3 — see every product listed under this CAS number, including other names
tert-Butyl 1-(Tosyloxy)-3,6,9,12-tetraoxapentadecan-15-oate, 97% (CAS 581065-94-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F875756-500MG |
| cas | 581065-94-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 206.20 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 1018.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 581065-94-3) is a chemical compound with the molecular formula C22H36O9S and a molecular weight of 476.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GGGJGMGLGUHUMW-UHFFFAOYSA-N.
| Molecular formula | C22H36O9S |
|---|---|
| Molecular weight | 476.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GGGJGMGLGUHUMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)