CAS 581065-94-3 appears in our catalog under these names: Tos-peg5 t-butyl ester, 98%, Tos-PEG5-Boc, Tos–PEG5–Boc, tert-Butyl 1-(Tosyloxy)-3,6,9,12-tetraoxapentadecan-15-oate, >98.0%(HPLC)(T), Tos-PEG5-Boc 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 50mg, 100mg, 500mg.
Tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 581065-94-3) is a chemical compound with the molecular formula C22H36O9S and a molecular weight of 476.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GGGJGMGLGUHUMW-UHFFFAOYSA-N.
| Molecular formula | C22H36O9S |
|---|---|
| Molecular weight | 476.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GGGJGMGLGUHUMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)