cas: 864684-96-8 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxa-7-azaspiro[3.5]nonane-7-carboxylate, 97% (CAS 864684-96-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323855-250MG |
| cas | 864684-96-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 10g | 1809.80 Pln | |
| Fluorochem | 25g | 4433.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 1-oxa-7-azaspiro[3.5]nonane-7-carboxylate (CAS 864684-96-8) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 1-oxa-7-azaspiro[3.5]nonane-7-carboxylate. InChIKey: WTKKPVRQCZKUDT-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 1-oxa-7-azaspiro[3.5]nonane-7-carboxylate |
| InChIKey | WTKKPVRQCZKUDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCO2 |
Computed by PubChem (NCBI)