cas: 1032158-48-7 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate, 97%, 97% (CAS 1032158-48-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118XX9-100mg |
| cas | 1032158-48-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 1032158-48-7) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: LQQAOPZWMYAJSP-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | LQQAOPZWMYAJSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC2=O |
Computed by PubChem (NCBI)