cas: 869527-80-0 — see every product listed under this CAS number, including other names
tert-Butyl 2,2-dimethylpyrrolidine-1-carboxylate (CAS 869527-80-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210381-250MG |
| cas | 869527-80-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 737.26 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2,2-dimethylpyrrolidine-1-carboxylate (CAS 869527-80-0) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl 2,2-dimethylpyrrolidine-1-carboxylate. InChIKey: BQWREAOXJRHDQX-UHFFFAOYSA-N.
| Molecular formula | C11H21NO2 |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | tert-butyl 2,2-dimethylpyrrolidine-1-carboxylate |
| InChIKey | BQWREAOXJRHDQX-UHFFFAOYSA-N |
| SMILES | CC1(CCCN1C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)