cas: 885270-84-8 — see every product listed under this CAS number, including other names
tert-Butyl 2,6-diazaspiro[3.4]octane-2-carboxylate, 98%, 98% (CAS 885270-84-8) is a chemical reagent available from Chemat. Available pack sizes: 250g, 500g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114F7F-250g |
| cas | 885270-84-8 |
| size | 250g |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 10758.80 Pln | |
| Chemat | 500g | 16368.00 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 1994.00 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 5920.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate (CAS 885270-84-8) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate. InChIKey: UJIOQJJFPYXAEM-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | UJIOQJJFPYXAEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCNC2 |
Computed by PubChem (NCBI)